C19H27N3O5 — CID 119622744
[4-(cyclopropylmethylamino)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone (PubChem CID 119622744) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-(cyclopropylmethylamino)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone.
| Compound Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 119622744 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(4-ethoxy-5-methoxy-2-nitrophenyl)methanone |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)N2CCC(NCC3CC3)CC2)cc1OC |
| InChI | InChI=1S/C19H27N3O5/c1-3-27-18-11-16(22(24)25)15(10-17(18)26-2)19(23)21-8-6-14(7-9-21)20-12-13-4-5-13/h10-11,13-14,20H,3-9,12H2,1-2H3 |
| InChIKey | ILFYBVZOLNUGFQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|