C23H27N3O8 — CID 55904696
(2,4-dimethoxyphenyl)-[4-(5-ethoxy-4-methoxy-2-nitrobenzoyl)piperazin-1-yl]methanone (PubChem CID 55904696) has the molecular formula C23H27N3O8 and a molecular weight of 473.48 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[4-(5-ethoxy-4-methoxy-2-nitrobenzoyl)piperazin-1-yl]methanone.
| Compound Name | (2,4-dimethoxyphenyl)-[4-(5-ethoxy-4-methoxy-2-nitrobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55904696 |
| Molecular Formula | C23H27N3O8 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[4-(5-ethoxy-4-methoxy-2-nitrobenzoyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cc(C(=O)N2CCN(C(=O)c3ccc(OC)cc3OC)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H27N3O8/c1-5-34-21-13-17(18(26(29)30)14-20(21)33-4)23(28)25-10-8-24(9-11-25)22(27)16-7-6-15(31-2)12-19(16)32-3/h6-7,12-14H,5,8-11H2,1-4H3 |
| InChIKey | LGMQHBBGBDVSEA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 120.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|