C15H21BrClN3O4 — CID 119661870
[4-(3-aminopropoxy)piperidin-1-yl]-(4-bromo-2-nitrophenyl)methanone;hydrochloride (PubChem CID 119661870) has the molecular formula C15H21BrClN3O4 and a molecular weight of 422.71 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(4-bromo-2-nitrophenyl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-bromo-2-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119661870 |
| Molecular Formula | C15H21BrClN3O4 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-bromo-2-nitrophenyl)methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)c2ccc(Br)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H20BrN3O4.ClH/c16-11-2-3-13(14(10-11)19(21)22)15(20)18-7-4-12(5-8-18)23-9-1-6-17;/h2-3,10,12H,1,4-9,17H2;1H |
| InChIKey | DSNXCALWKQSCSK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|