C15H20BrClN2O2 — CID 103807747
[4-(3-aminopropoxy)piperidin-1-yl]-(2-bromo-4-chlorophenyl)methanone (PubChem CID 103807747) has the molecular formula C15H20BrClN2O2 and a molecular weight of 375.69 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(2-bromo-4-chlorophenyl)methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(2-bromo-4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 103807747 |
| Molecular Formula | C15H20BrClN2O2 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(2-bromo-4-chlorophenyl)methanone |
| SMILES | NCCCOC1CCN(C(=O)c2ccc(Cl)cc2Br)CC1 |
| InChI | InChI=1S/C15H20BrClN2O2/c16-14-10-11(17)2-3-13(14)15(20)19-7-4-12(5-8-19)21-9-1-6-18/h2-3,10,12H,1,4-9,18H2 |
| InChIKey | LEWOOOWXUUYEMD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|