C13H16N2O5 — CID 58005522
4-(4-methoxybutyl)-6-nitro-1,4-benzoxazin-3-one (PubChem CID 58005522) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-(4-methoxybutyl)-6-nitro-1,4-benzoxazin-3-one.
| Compound Name | 4-(4-methoxybutyl)-6-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 58005522 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-(4-methoxybutyl)-6-nitro-1,4-benzoxazin-3-one |
| SMILES | COCCCCN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H16N2O5/c1-19-7-3-2-6-14-11-8-10(15(17)18)4-5-12(11)20-9-13(14)16/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | WVHCISLDRNYCQY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|