C16H24N2O5Si — CID 58653174
4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-1,4-benzoxazin-3-one (PubChem CID 58653174) has the molecular formula C16H24N2O5Si and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 58653174 |
| Molecular Formula | C16H24N2O5Si |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-1,4-benzoxazin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H24N2O5Si/c1-16(2,3)24(4,5)23-9-8-17-13-10-12(18(20)21)6-7-14(13)22-11-15(17)19/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | ONCGTGBUUXBKOZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|