C17H26N2O4Si — CID 68706195
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-nitro-3,4-dihydroquinolin-2-one (PubChem CID 68706195) has the molecular formula C17H26N2O4Si and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-nitro-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-nitro-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68706195 |
| Molecular Formula | C17H26N2O4Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-nitro-3,4-dihydroquinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C(=O)CCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O4Si/c1-17(2,3)24(4,5)23-12-11-18-14-7-6-8-15(19(21)22)13(14)9-10-16(18)20/h6-8H,9-12H2,1-5H3 |
| InChIKey | WHHAYXSNOCJPMQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|