C19H30N2O3Si — CID 58719562
3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-phenyl-1,3-diazinane-2,4-dione (PubChem CID 58719562) has the molecular formula C19H30N2O3Si and a molecular weight of 362.55 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-phenyl-1,3-diazinane-2,4-dione.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-phenyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 58719562 |
| Molecular Formula | C19H30N2O3Si |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-phenyl-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCCN1C(=O)CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H30N2O3Si/c1-19(2,3)25(4,5)24-15-9-13-21-17(22)12-14-20(18(21)23)16-10-7-6-8-11-16/h6-8,10-11H,9,12-15H2,1-5H3 |
| InChIKey | IMXLQPFUZZLROM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|