C23H38N2O4Si — CID 67074343
benzyl 4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-oxo-1,4-diazepane-1-carboxylate (PubChem CID 67074343) has the molecular formula C23H38N2O4Si and a molecular weight of 434.65 g/mol. Its IUPAC name is benzyl 4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-oxo-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-oxo-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 67074343 |
| Molecular Formula | C23H38N2O4Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | benzyl 4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-5-oxo-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCN1CCN(C(=O)OCc2ccccc2)CCC1=O |
| InChI | InChI=1S/C23H38N2O4Si/c1-23(2,3)30(4,5)29-18-10-9-14-24-16-17-25(15-13-21(24)26)22(27)28-19-20-11-7-6-8-12-20/h6-8,11-12H,9-10,13-19H2,1-5H3 |
| InChIKey | CJCMHBCUCHESGV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|