C27H40N2O5SSi — CID 131748131
benzyl (3S)-4-(benzenesulfonyl)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperazine-1-carboxylate (PubChem CID 131748131) has the molecular formula C27H40N2O5SSi and a molecular weight of 532.78 g/mol. Its IUPAC name is benzyl (3S)-4-(benzenesulfonyl)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3S)-4-(benzenesulfonyl)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 131748131 |
| Molecular Formula | C27H40N2O5SSi |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | benzyl (3S)-4-(benzenesulfonyl)-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@H]1CN(C(=O)OCc2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H40N2O5SSi/c1-27(2,3)36(4,5)34-20-12-15-24-21-28(26(30)33-22-23-13-8-6-9-14-23)18-19-29(24)35(31,32)25-16-10-7-11-17-25/h6-11,13-14,16-17,24H,12,15,18-22H2,1-5H3/t24-/m0/s1 |
| InChIKey | URICJIVMKNEVQZ-DEOSSOPVSA-N |
| XLogP | 5.50 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|