C20H31N3O3Si — CID 140869942
benzyl (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyanopiperazine-1-carboxylate (PubChem CID 140869942) has the molecular formula C20H31N3O3Si and a molecular weight of 389.57 g/mol. Its IUPAC name is benzyl (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyanopiperazine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyanopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 140869942 |
| Molecular Formula | C20H31N3O3Si |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | benzyl (3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyanopiperazine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CN(C(=O)OCc2ccccc2)CCN1C#N |
| InChI | InChI=1S/C20H31N3O3Si/c1-20(2,3)27(4,5)26-15-18-13-22(11-12-23(18)16-21)19(24)25-14-17-9-7-6-8-10-17/h6-10,18H,11-15H2,1-5H3/t18-/m0/s1 |
| InChIKey | SQXIJFWWTQULCH-SFHVURJKSA-N |
| XLogP | 3.81 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|