C22H33NO6Si — CID 10410733
3-O-benzyl 1-O-ethyl (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-1,3-dicarboxylate (PubChem CID 10410733) has the molecular formula C22H33NO6Si and a molecular weight of 435.59 g/mol. Its IUPAC name is 3-O-benzyl 1-O-ethyl (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-1,3-dicarboxylate.
| Compound Name | 3-O-benzyl 1-O-ethyl (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10410733 |
| Molecular Formula | C22H33NO6Si |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 3-O-benzyl 1-O-ethyl (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)N1C(=O)C(C(=O)OCc2ccccc2)C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H33NO6Si/c1-7-27-21(26)23-17(15-29-30(5,6)22(2,3)4)13-18(19(23)24)20(25)28-14-16-11-9-8-10-12-16/h8-12,17-18H,7,13-15H2,1-6H3/t17-,18?/m0/s1 |
| InChIKey | XAGQVEIJKILQQN-ZENAZSQFSA-N |
| XLogP | 4.13 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|