C32H55NO5Si2 — CID 46894526
benzyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-6-[3-tri(propan-2-yl)silyloxypropyl]-2,3-dihydropyridine-1-carboxylate (PubChem CID 46894526) has the molecular formula C32H55NO5Si2 and a molecular weight of 589.97 g/mol. Its IUPAC name is benzyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-6-[3-tri(propan-2-yl)silyloxypropyl]-2,3-dihydropyridine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-6-[3-tri(propan-2-yl)silyloxypropyl]-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 46894526 |
| Molecular Formula | C32H55NO5Si2 |
| Molecular Weight | 589.97 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | benzyl (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-6-[3-tri(propan-2-yl)silyloxypropyl]-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC(C)[Si](OCCCC1=CC(=O)C[C@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H55NO5Si2/c1-24(2)40(25(3)4,26(5)6)37-19-15-18-28-20-30(34)21-29(23-38-39(10,11)32(7,8)9)33(28)31(35)36-22-27-16-13-12-14-17-27/h12-14,16-17,20,24-26,29H,15,18-19,21-23H2,1-11H3/t29-/m1/s1 |
| InChIKey | FCFDQQXEUHRWEY-GDLZYMKVSA-N |
| XLogP | 8.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.97 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|