C22H33NO4Si — CID 162782558
benzyl (2S,3aS,6aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate (PubChem CID 162782558) has the molecular formula C22H33NO4Si and a molecular weight of 403.60 g/mol. Its IUPAC name is benzyl (2S,3aS,6aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | benzyl (2S,3aS,6aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 162782558 |
| Molecular Formula | C22H33NO4Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | benzyl (2S,3aS,6aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C(=O)[C@H]2CCC[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H33NO4Si/c1-22(2,3)28(4,5)27-15-19-20(24)17-12-9-13-18(17)23(19)21(25)26-14-16-10-7-6-8-11-16/h6-8,10-11,17-19H,9,12-15H2,1-5H3/t17-,18+,19-/m0/s1 |
| InChIKey | AEMJVQIDRFUOGC-OTWHNJEPSA-N |
| XLogP | 4.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|