C21H33NO3Si — CID 171372709
benzyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-azaspiro[2.4]heptane-5-carboxylate (PubChem CID 171372709) has the molecular formula C21H33NO3Si and a molecular weight of 375.59 g/mol. Its IUPAC name is benzyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-azaspiro[2.4]heptane-5-carboxylate.
| Compound Name | benzyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-azaspiro[2.4]heptane-5-carboxylate |
|---|---|
| PubChem CID | 171372709 |
| Molecular Formula | C21H33NO3Si |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | benzyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-azaspiro[2.4]heptane-5-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC2(CC2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H33NO3Si/c1-20(2,3)26(4,5)25-15-18-13-21(11-12-21)16-22(18)19(23)24-14-17-9-7-6-8-10-17/h6-10,18H,11-16H2,1-5H3 |
| InChIKey | JWTGNVUXLDDPBK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|