C23H37NO4Si — CID 175972992
7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-6-azaspiro[3.5]nonane-6-carboxylic acid (PubChem CID 175972992) has the molecular formula C23H37NO4Si and a molecular weight of 419.64 g/mol. Its IUPAC name is 7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-6-azaspiro[3.5]nonane-6-carboxylic acid.
| Compound Name | 7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-6-azaspiro[3.5]nonane-6-carboxylic acid |
|---|---|
| PubChem CID | 175972992 |
| Molecular Formula | C23H37NO4Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-6-azaspiro[3.5]nonane-6-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC2(CCC2OCc2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C23H37NO4Si/c1-22(2,3)29(4,5)28-16-19-11-13-23(17-24(19)21(25)26)14-12-20(23)27-15-18-9-7-6-8-10-18/h6-10,19-20H,11-17H2,1-5H3,(H,25,26) |
| InChIKey | LPCKIDVUHSWEGJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|