C20H33NOSi — CID 131749610
[(5S)-4-benzyl-4-azaspiro[2.4]heptan-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 131749610) has the molecular formula C20H33NOSi and a molecular weight of 331.58 g/mol. Its IUPAC name is [(5S)-4-benzyl-4-azaspiro[2.4]heptan-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(5S)-4-benzyl-4-azaspiro[2.4]heptan-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 131749610 |
| Molecular Formula | C20H33NOSi |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | [(5S)-4-benzyl-4-azaspiro[2.4]heptan-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC2(CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H33NOSi/c1-19(2,3)23(4,5)22-16-18-11-12-20(13-14-20)21(18)15-17-9-7-6-8-10-17/h6-10,18H,11-16H2,1-5H3/t18-/m0/s1 |
| InChIKey | GOFNDOOAMPDGTD-SFHVURJKSA-N |
| XLogP | 5.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|