C25H36N2O2Si — CID 123771378
1,4-dibenzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperazin-2-one (PubChem CID 123771378) has the molecular formula C25H36N2O2Si and a molecular weight of 424.66 g/mol. Its IUPAC name is 1,4-dibenzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperazin-2-one.
| Compound Name | 1,4-dibenzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperazin-2-one |
|---|---|
| PubChem CID | 123771378 |
| Molecular Formula | C25H36N2O2Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1,4-dibenzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperazin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CN(Cc2ccccc2)CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H36N2O2Si/c1-25(2,3)30(4,5)29-20-23-18-26(16-21-12-8-6-9-13-21)19-24(28)27(23)17-22-14-10-7-11-15-22/h6-15,23H,16-20H2,1-5H3 |
| InChIKey | NVMMGVGCBRLNNE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|