C37H53NO4Si2 — CID 131747383
4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methylmorpholin-3-one (PubChem CID 131747383) has the molecular formula C37H53NO4Si2 and a molecular weight of 632.01 g/mol. Its IUPAC name is 4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methylmorpholin-3-one.
| Compound Name | 4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methylmorpholin-3-one |
|---|---|
| PubChem CID | 131747383 |
| Molecular Formula | C37H53NO4Si2 |
| Molecular Weight | 632.01 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | 4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-methylmorpholin-3-one |
| SMILES | CC1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCC(CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C37H53NO4Si2/c1-35(2,3)43(8,9)42-29-31-28-40-37(7,34(39)38(31)27-30-19-13-10-14-20-30)25-26-41-44(36(4,5)6,32-21-15-11-16-22-32)33-23-17-12-18-24-33/h10-24,31H,25-29H2,1-9H3 |
| InChIKey | GAUNSZMDOZQEAZ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.01 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|