C21H35NO3Si — CID 123921176
4-benzyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylmorpholin-3-one (PubChem CID 123921176) has the molecular formula C21H35NO3Si and a molecular weight of 377.60 g/mol. Its IUPAC name is 4-benzyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylmorpholin-3-one.
| Compound Name | 4-benzyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylmorpholin-3-one |
|---|---|
| PubChem CID | 123921176 |
| Molecular Formula | C21H35NO3Si |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 4-benzyl-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylmorpholin-3-one |
| SMILES | CC1(C)OCC(CCO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H35NO3Si/c1-20(2,3)26(6,7)25-14-13-18-16-24-21(4,5)19(23)22(18)15-17-11-9-8-10-12-17/h8-12,18H,13-16H2,1-7H3 |
| InChIKey | NCNWDEIEAIEGHN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|