C21H38N2OSi — CID 176897495
2-[(2R)-4-benzyl-1-ethylpiperazin-2-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 176897495) has the molecular formula C21H38N2OSi and a molecular weight of 362.63 g/mol. Its IUPAC name is 2-[(2R)-4-benzyl-1-ethylpiperazin-2-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(2R)-4-benzyl-1-ethylpiperazin-2-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 176897495 |
| Molecular Formula | C21H38N2OSi |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 2-[(2R)-4-benzyl-1-ethylpiperazin-2-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CCN1CCN(Cc2ccccc2)C[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38N2OSi/c1-7-23-15-14-22(17-19-11-9-8-10-12-19)18-20(23)13-16-24-25(5,6)21(2,3)4/h8-12,20H,7,13-18H2,1-6H3/t20-/m1/s1 |
| InChIKey | WDZIYAQCVWJGIA-HXUWFJFHSA-N |
| XLogP | 4.60 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|