C24H42N2O3Si — CID 67330677
tert-butyl N-(1-benzylpyrrolidin-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]carbamate (PubChem CID 67330677) has the molecular formula C24H42N2O3Si and a molecular weight of 434.70 g/mol. Its IUPAC name is tert-butyl N-(1-benzylpyrrolidin-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-(1-benzylpyrrolidin-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 67330677 |
| Molecular Formula | C24H42N2O3Si |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | tert-butyl N-(1-benzylpyrrolidin-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO[Si](C)(C)C(C)(C)C)C1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H42N2O3Si/c1-23(2,3)29-22(27)26(16-17-28-30(7,8)24(4,5)6)21-14-15-25(19-21)18-20-12-10-9-11-13-20/h9-13,21H,14-19H2,1-8H3 |
| InChIKey | VMDAJYLCRRWYPN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|