C21H34N2O2 — CID 140627422
tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate (PubChem CID 140627422) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate.
| Compound Name | tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140627422 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCCN(Cc2ccccc2)C1)C(C)(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-20(2,3)23(19(24)25-21(4,5)6)18-13-10-14-22(16-18)15-17-11-8-7-9-12-17/h7-9,11-12,18H,10,13-16H2,1-6H3 |
| InChIKey | PBRLIXJZLIVXPU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |