tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate

C21H34N2O2 — CID 140627422

IUPACtert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate
SMILESCC(C)(C)OC(=O)N(C1CCCN(Cc2ccccc2)C1)C(C)(C)C
InChIInChI=1S/C21H34N2O2/c1-20(2,3)23(19(24)25-21(4,5)6)18-13-10-14-22(16-18)15-17-11-8-7-9-12-17/h7-9,11-12,18H,10,13-16H2,1-6H3
InChIKeyPBRLIXJZLIVXPU-UHFFFAOYSA-N
MW346.52 g/mol
LogP4.69
Rot. Bonds3

About tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate

tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate (PubChem CID 140627422) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate.

Molecular Properties

Compound Nametert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate
PubChem CID140627422
Molecular FormulaC21H34N2O2
Molecular Weight346.52 g/mol
Exact Mass346.26
IUPAC Nametert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate
SMILESCC(C)(C)OC(=O)N(C1CCCN(Cc2ccccc2)C1)C(C)(C)C
InChIInChI=1S/C21H34N2O2/c1-20(2,3)23(19(24)25-21(4,5)6)18-13-10-14-22(16-18)15-17-11-8-7-9-12-17/h7-9,11-12,18H,10,13-16H2,1-6H3
InChIKeyPBRLIXJZLIVXPU-UHFFFAOYSA-N
XLogP4.69
TPSA32.78 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.52
LogP ≤ 54.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate?
The IUPAC name of tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate (CID 140627422) is tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate.
What is the SMILES notation for tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate?
The canonical SMILES for tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate is CC(C)(C)OC(=O)N(C1CCCN(Cc2ccccc2)C1)C(C)(C)C.
What is the InChIKey of tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate?
The InChIKey is PBRLIXJZLIVXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O2/c1-20(2,3)23(19(24)25-21(4,5)6)18-13-10-14-22(16-18)15-17-11-8-7-9-12-17/h7-9,11-12,18H,10,13-16H2,1-6H3.
What are the key properties of tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate?
tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate has a molecular weight of 346.52 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(1-benzylpiperidin-3-yl)-N-tert-butylcarbamate is sourced from PubChem (CID 140627422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).