C27H35N3O3 — CID 58996395
tert-butyl N-(1-benzylpiperidin-4-yl)-N-[3-(4-isocyanophenoxy)propyl]carbamate (PubChem CID 58996395) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is tert-butyl N-(1-benzylpiperidin-4-yl)-N-[3-(4-isocyanophenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-(1-benzylpiperidin-4-yl)-N-[3-(4-isocyanophenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 58996395 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | tert-butyl N-(1-benzylpiperidin-4-yl)-N-[3-(4-isocyanophenoxy)propyl]carbamate |
| SMILES | [C-]#[N+]c1ccc(OCCCN(C(=O)OC(C)(C)C)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H35N3O3/c1-27(2,3)33-26(31)30(17-8-20-32-25-13-11-23(28-4)12-14-25)24-15-18-29(19-16-24)21-22-9-6-5-7-10-22/h5-7,9-14,24H,8,15-21H2,1-3H3 |
| InChIKey | QFPYMHKEXHFSPW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|