C17H26AsNO2 — CID 173186373
tert-butyl (1-benzylpiperidin-4-yl)arsanylformate (PubChem CID 173186373) has the molecular formula C17H26AsNO2 and a molecular weight of 351.32 g/mol. Its IUPAC name is tert-butyl (1-benzylpiperidin-4-yl)arsanylformate.
| Compound Name | tert-butyl (1-benzylpiperidin-4-yl)arsanylformate |
|---|---|
| PubChem CID | 173186373 |
| Molecular Formula | C17H26AsNO2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | tert-butyl (1-benzylpiperidin-4-yl)arsanylformate |
| SMILES | CC(C)(C)OC(=O)[AsH]C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H26AsNO2/c1-17(2,3)21-16(20)18-15-9-11-19(12-10-15)13-14-7-5-4-6-8-14/h4-8,15,18H,9-13H2,1-3H3 |
| InChIKey | FEZJYGICVJTDGK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|