C25H34N2O2 — CID 14997630
tert-butyl (2S)-2-[(1-benzylpiperidin-4-yl)amino]-3-phenylpropanoate (PubChem CID 14997630) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1-benzylpiperidin-4-yl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[(1-benzylpiperidin-4-yl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 14997630 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | tert-butyl (2S)-2-[(1-benzylpiperidin-4-yl)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N2O2/c1-25(2,3)29-24(28)23(18-20-10-6-4-7-11-20)26-22-14-16-27(17-15-22)19-21-12-8-5-9-13-21/h4-13,22-23,26H,14-19H2,1-3H3/t23-/m0/s1 |
| InChIKey | KECGRWVONSSFRZ-QHCPKHFHSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |