C26H35N3O3 — CID 54190281
tert-butyl N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N-(1-benzylpiperidin-4-yl)carbamate (PubChem CID 54190281) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N-(1-benzylpiperidin-4-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N-(1-benzylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 54190281 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | tert-butyl N-(1-amino-1-oxo-3-phenylpropan-2-yl)-N-(1-benzylpiperidin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCN(Cc2ccccc2)CC1)C(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C26H35N3O3/c1-26(2,3)32-25(31)29(23(24(27)30)18-20-10-6-4-7-11-20)22-14-16-28(17-15-22)19-21-12-8-5-9-13-21/h4-13,22-23H,14-19H2,1-3H3,(H2,27,30) |
| InChIKey | PIAMYPMXQXRIGF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |