C15H21NO7 — CID 46867571
tert-butyl (2R)-2-(hydroxyamino)-3-phenylpropanoate;oxalic acid (PubChem CID 46867571) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-(hydroxyamino)-3-phenylpropanoate;oxalic acid.
| Compound Name | tert-butyl (2R)-2-(hydroxyamino)-3-phenylpropanoate;oxalic acid |
|---|---|
| PubChem CID | 46867571 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | tert-butyl (2R)-2-(hydroxyamino)-3-phenylpropanoate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](Cc1ccccc1)NO.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19NO3.C2H2O4/c1-13(2,3)17-12(15)11(14-16)9-10-7-5-4-6-8-10;3-1(4)2(5)6/h4-8,11,14,16H,9H2,1-3H3;(H,3,4)(H,5,6)/t11-;/m1./s1 |
| InChIKey | HGMMOSIAVAFLKY-RFVHGSKJSA-N |
| XLogP | 1.07 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|