C18H27NO4 — CID 10687240
methyl 3-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]butanoate (PubChem CID 10687240) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]butanoate.
| Compound Name | methyl 3-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 10687240 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | methyl 3-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]butanoate |
| SMILES | COC(=O)CC(C)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO4/c1-13(11-16(20)22-5)19-15(17(21)23-18(2,3)4)12-14-9-7-6-8-10-14/h6-10,13,15,19H,11-12H2,1-5H3/t13?,15-/m0/s1 |
| InChIKey | MTJIRROBJSQOFG-WUJWULDRSA-N |
| XLogP | 2.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |