C16H27NO2S — CID 159183112
tert-butyl (2S)-3-phenyl-2-(propan-2-ylamino)propanoate;sulfane (PubChem CID 159183112) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is tert-butyl (2S)-3-phenyl-2-(propan-2-ylamino)propanoate;sulfane.
| Compound Name | tert-butyl (2S)-3-phenyl-2-(propan-2-ylamino)propanoate;sulfane |
|---|---|
| PubChem CID | 159183112 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | tert-butyl (2S)-3-phenyl-2-(propan-2-ylamino)propanoate;sulfane |
| SMILES | CC(C)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C.S |
| InChI | InChI=1S/C16H25NO2.H2S/c1-12(2)17-14(15(18)19-16(3,4)5)11-13-9-7-6-8-10-13;/h6-10,12,14,17H,11H2,1-5H3;1H2/t14-;/m0./s1 |
| InChIKey | KNDMKTOHIAEAPU-UQKRIMTDSA-N |
| XLogP | 3.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |