C15H18F3NO3 — CID 11130916
tert-butyl (2R)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 11130916) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is tert-butyl (2R)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 11130916 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | tert-butyl (2R)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO3/c1-14(2,3)22-12(20)11(19-13(21)15(16,17)18)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | XZEZEVLEZSJKLA-LLVKDONJSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |