C14H16F3NO3 — CID 11347207
propyl 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 11347207) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is propyl 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | propyl 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 11347207 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | propyl 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO3/c1-2-8-21-12(19)11(18-13(20)14(15,16)17)9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,18,20) |
| InChIKey | JHDCNBPPZIIXOE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |