C12H11ClF3NO2 — CID 75966680
N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 75966680) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 75966680 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCl)C(Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF3NO2/c13-7-10(18)9(17-11(19)12(14,15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,17,19) |
| InChIKey | GEXLBTILZPMQBV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|