C16H23NO2 — CID 67704235
2,2-dimethyl-N-[(2R)-3-oxo-1-phenylpentan-2-yl]propanamide (PubChem CID 67704235) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2R)-3-oxo-1-phenylpentan-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2R)-3-oxo-1-phenylpentan-2-yl]propanamide |
|---|---|
| PubChem CID | 67704235 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2,2-dimethyl-N-[(2R)-3-oxo-1-phenylpentan-2-yl]propanamide |
| SMILES | CCC(=O)[C@@H](Cc1ccccc1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H23NO2/c1-5-14(18)13(17-15(19)16(2,3)4)11-12-9-7-6-8-10-12/h6-10,13H,5,11H2,1-4H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | MLTNKCUBNYBKNG-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |