C17H24ClNO3 — CID 174435245
2-(2,2-dimethylpropanoylamino)-3-phenylpropanoyl chloride;propan-2-one (PubChem CID 174435245) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-3-phenylpropanoyl chloride;propan-2-one.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-3-phenylpropanoyl chloride;propan-2-one |
|---|---|
| PubChem CID | 174435245 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-3-phenylpropanoyl chloride;propan-2-one |
| SMILES | CC(C)(C)C(=O)NC(Cc1ccccc1)C(=O)Cl.CC(C)=O |
| InChI | InChI=1S/C14H18ClNO2.C3H6O/c1-14(2,3)13(18)16-11(12(15)17)9-10-7-5-4-6-8-10;1-3(2)4/h4-8,11H,9H2,1-3H3,(H,16,18);1-2H3 |
| InChIKey | VEQYDWSMYCLCIE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|