C21H35N3O2 — CID 164831418
N-[(2S)-1-[2-(2,2-dimethylpropylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,2-dimethylpropanamide (PubChem CID 164831418) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-[(2S)-1-[2-(2,2-dimethylpropylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2S)-1-[2-(2,2-dimethylpropylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 164831418 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | N-[(2S)-1-[2-(2,2-dimethylpropylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)CNCCNC(=O)[C@H](Cc1ccccc1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H35N3O2/c1-20(2,3)15-22-12-13-23-18(25)17(24-19(26)21(4,5)6)14-16-10-8-7-9-11-16/h7-11,17,22H,12-15H2,1-6H3,(H,23,25)(H,24,26)/t17-/m0/s1 |
| InChIKey | JOKVFBFSPSXZRX-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|