C15H23NO — CID 51374320
2,2-dimethyl-N-[(2S)-4-phenylbutan-2-yl]propanamide (PubChem CID 51374320) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2S)-4-phenylbutan-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2S)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 51374320 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2,2-dimethyl-N-[(2S)-4-phenylbutan-2-yl]propanamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H23NO/c1-12(16-14(17)15(2,3)4)10-11-13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | NGUNBIGBAQEKGP-LBPRGKRZSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |