C12H14F3NO — CID 4564814
2,2,2-trifluoro-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 4564814) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 4564814 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO/c1-9(16-11(17)12(13,14)15)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,16,17) |
| InChIKey | MDBNHAHKSSMQME-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |