C13H14F3NO3 — CID 14390812
(2S)-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid (PubChem CID 14390812) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is (2S)-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid.
| Compound Name | (2S)-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 14390812 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (2S)-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
| SMILES | O=C(O)[C@H](CCCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3/c14-13(15,16)12(20)17-10(11(18)19)8-4-7-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | CZUFCRYWCZYGRZ-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |