C15H19F3N2O3 — CID 86612160
benzyl (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 86612160) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is benzyl (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | benzyl (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 86612160 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | benzyl (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19F3N2O3/c16-15(17,18)14(22)20-12(8-4-5-9-19)13(21)23-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,19H2,(H,20,22)/t12-/m0/s1 |
| InChIKey | LTUROQOHTYFDNY-LBPRGKRZSA-N |
| XLogP | 1.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|