C24H31N3O5 — CID 102071463
benzyl (2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate (PubChem CID 102071463) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is benzyl (2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate.
| Compound Name | benzyl (2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 102071463 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | benzyl (2S)-6-amino-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O5/c1-18(26-24(30)32-17-20-12-6-3-7-13-20)22(28)27-21(14-8-9-15-25)23(29)31-16-19-10-4-2-5-11-19/h2-7,10-13,18,21H,8-9,14-17,25H2,1H3,(H,26,30)(H,27,28)/t18-,21-/m0/s1 |
| InChIKey | YBKGAUOFVYGRFE-RXVVDRJESA-N |
| XLogP | 2.66 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|