C32H43N3O8 — CID 11840940
benzyl (2S)-6-[[(2S,3S,4S)-3-formyl-2-hydroxy-4-methylhexanoyl]amino]-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate (PubChem CID 11840940) has the molecular formula C32H43N3O8 and a molecular weight of 597.71 g/mol. Its IUPAC name is benzyl (2S)-6-[[(2S,3S,4S)-3-formyl-2-hydroxy-4-methylhexanoyl]amino]-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate.
| Compound Name | benzyl (2S)-6-[[(2S,3S,4S)-3-formyl-2-hydroxy-4-methylhexanoyl]amino]-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 11840940 |
| Molecular Formula | C32H43N3O8 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | benzyl (2S)-6-[[(2S,3S,4S)-3-formyl-2-hydroxy-4-methylhexanoyl]amino]-2-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoate |
| SMILES | CC[C@H](C)[C@H](C=O)[C@H](O)C(=O)NCCCC[C@H](NC(=O)[C@@H](C)NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H43N3O8/c1-4-22(2)26(19-36)28(37)30(39)33-18-12-11-17-27(31(40)42-20-24-13-7-5-8-14-24)35-29(38)23(3)34-32(41)43-21-25-15-9-6-10-16-25/h5-10,13-16,19,22-23,26-28,37H,4,11-12,17-18,20-21H2,1-3H3,(H,33,39)(H,34,41)(H,35,38)/t22-,23+,26-,27-,28-/m0/s1 |
| InChIKey | ODPOWFGUTQNCGV-CBBNSXQPSA-N |
| XLogP | 3.04 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|