C25H38N4O8 — CID 15480283
methyl 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]acetate (PubChem CID 15480283) has the molecular formula C25H38N4O8 and a molecular weight of 522.60 g/mol. Its IUPAC name is methyl 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 15480283 |
| Molecular Formula | C25H38N4O8 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | methyl 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H38N4O8/c1-17(28-24(34)36-16-18-11-7-6-8-12-18)21(31)29-19(22(32)27-15-20(30)35-5)13-9-10-14-26-23(33)37-25(2,3)4/h6-8,11-12,17,19H,9-10,13-16H2,1-5H3,(H,26,33)(H,27,32)(H,28,34)(H,29,31)/t17-,19-/m0/s1 |
| InChIKey | FEVYNPNMZGVBKC-HKUYNNGSSA-N |
| XLogP | 1.77 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|