C22H34N2O5 — CID 10669075
ethyl 7-oxo-7-(pentylamino)-2-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 10669075) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is ethyl 7-oxo-7-(pentylamino)-2-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | ethyl 7-oxo-7-(pentylamino)-2-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 10669075 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | ethyl 7-oxo-7-(pentylamino)-2-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | CCCCCNC(=O)CCCCC(NC(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C22H34N2O5/c1-3-5-11-16-23-20(25)15-10-9-14-19(21(26)28-4-2)24-22(27)29-17-18-12-7-6-8-13-18/h6-8,12-13,19H,3-5,9-11,14-17H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | IAOMDZONTMBQFT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|