C20H28N2O8 — CID 59821487
ethyl (2S)-5-[[(2S)-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 59821487) has the molecular formula C20H28N2O8 and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl (2S)-5-[[(2S)-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl (2S)-5-[[(2S)-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 59821487 |
| Molecular Formula | C20H28N2O8 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethyl (2S)-5-[[(2S)-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCOC(=O)[C@H](CO)NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C20H28N2O8/c1-3-28-18(25)15(22-20(27)30-13-14-8-6-5-7-9-14)10-11-17(24)21-16(12-23)19(26)29-4-2/h5-9,15-16,23H,3-4,10-13H2,1-2H3,(H,21,24)(H,22,27)/t15-,16-/m0/s1 |
| InChIKey | QNLGHZFURJWJNV-HOTGVXAUSA-N |
| XLogP | 0.66 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|