C21H24N2O6 — CID 130151248
ethyl 2,3-bis(phenylmethoxycarbonylamino)propanoate (PubChem CID 130151248) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is ethyl 2,3-bis(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl 2,3-bis(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 130151248 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | ethyl 2,3-bis(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)C(CNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O6/c1-2-27-19(24)18(23-21(26)29-15-17-11-7-4-8-12-17)13-22-20(25)28-14-16-9-5-3-6-10-16/h3-12,18H,2,13-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | MBQOYUCDYWAMQM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|