C21H32N2O7 — CID 100985516
ethyl (2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 100985516) has the molecular formula C21H32N2O7 and a molecular weight of 424.49 g/mol. Its IUPAC name is ethyl (2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | ethyl (2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 100985516 |
| Molecular Formula | C21H32N2O7 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | ethyl (2S,5S)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)[C@H](CC[C@H](O)CNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O7/c1-5-28-18(25)17(23-20(27)30-21(2,3)4)12-11-16(24)13-22-19(26)29-14-15-9-7-6-8-10-15/h6-10,16-17,24H,5,11-14H2,1-4H3,(H,22,26)(H,23,27)/t16-,17-/m0/s1 |
| InChIKey | NFGQYSSXQIFEAA-IRXDYDNUSA-N |
| XLogP | 2.51 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|