C13H19NO6 — CID 174458411
benzyl 2-(ethoxycarbonylamino)-3-hydroxypropanoate;hydrate (PubChem CID 174458411) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is benzyl 2-(ethoxycarbonylamino)-3-hydroxypropanoate;hydrate.
| Compound Name | benzyl 2-(ethoxycarbonylamino)-3-hydroxypropanoate;hydrate |
|---|---|
| PubChem CID | 174458411 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | benzyl 2-(ethoxycarbonylamino)-3-hydroxypropanoate;hydrate |
| SMILES | CCOC(=O)NC(CO)C(=O)OCc1ccccc1.O |
| InChI | InChI=1S/C13H17NO5.H2O/c1-2-18-13(17)14-11(8-15)12(16)19-9-10-6-4-3-5-7-10;/h3-7,11,15H,2,8-9H2,1H3,(H,14,17);1H2 |
| InChIKey | SAPSRIODYLDEDV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |