C15H23N3O5 — CID 143560156
2-aminoacetamide;benzyl 3-hydroxy-2-(propanoylamino)propanoate (PubChem CID 143560156) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-aminoacetamide;benzyl 3-hydroxy-2-(propanoylamino)propanoate.
| Compound Name | 2-aminoacetamide;benzyl 3-hydroxy-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 143560156 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-aminoacetamide;benzyl 3-hydroxy-2-(propanoylamino)propanoate |
| SMILES | CCC(=O)NC(CO)C(=O)OCc1ccccc1.NCC(N)=O |
| InChI | InChI=1S/C13H17NO4.C2H6N2O/c1-2-12(16)14-11(8-15)13(17)18-9-10-6-4-3-5-7-10;3-1-2(4)5/h3-7,11,15H,2,8-9H2,1H3,(H,14,16);1,3H2,(H2,4,5) |
| InChIKey | PIYXSNQVNVCRAR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |