C14H18N2O4 — CID 14420417
benzyl (2S)-2-acetamido-5-amino-5-oxopentanoate (PubChem CID 14420417) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is benzyl (2S)-2-acetamido-5-amino-5-oxopentanoate.
| Compound Name | benzyl (2S)-2-acetamido-5-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 14420417 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | benzyl (2S)-2-acetamido-5-amino-5-oxopentanoate |
| SMILES | CC(=O)N[C@@H](CCC(N)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-10(17)16-12(7-8-13(15)18)14(19)20-9-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H2,15,18)(H,16,17)/t12-/m0/s1 |
| InChIKey | LAIRNPJEIMZKIB-LBPRGKRZSA-N |
| XLogP | 0.50 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |